Identitet
Timolol Dimorpholine Impurity
Inte angivet · C10H16N4O2S
01Identitet
| Lazychem ID | LC-29670 |
|---|---|
| CAS RN | Inte angivet |
| PubChem CID | 85871031 |
| Molecular formula | C10H16N4O2S |
| Molecular weight | 256.32 |
| IUPAC name | 3,4-dimorpholino-1,2,5-thiadiazole |
| InChIKey | NCRALNVQFLNMRK-UHFFFAOYSA-N |
02Struktur och stereokemi
2D structurePubChem CID 85871031

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | C3CN(c1nsnc1N2CCOCC2)CCO3 |
|---|---|
| InChI | Inte angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namn och relationer
API och moderläkemedel
Timolol
Föroreningar och relaterade föreningarNamn och relationer
05Källor
- S01PubChem CID 85871031
Structure and machine-readable chemical identifiers.
