Identitet
N-Nitroso Sumatriptan
Inte angivet · C14H20N4O3S
01Identitet
| Lazychem ID | LC-32215 |
|---|---|
| CAS RN | Inte angivet |
| PubChem CID | 176481793 |
| Molecular formula | C14H20N4O3S |
| Molecular weight | 324.4 g/mol |
| IUPAC name | 1-(3-(2-(Dimethylamino)ethyl)-1-nitroso-1H-indol-5-yl)-N-methylmethanesulfonamide |
| InChIKey | JPGJQBLQEXDIRR-UHFFFAOYSA-N |
02Struktur och stereokemi
2D structurePubChem CID 176481793

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | O=S(CC1=CC2=C(N(N=O)C=C2CCN(C)C)C=C1)(NC)=O |
|---|---|
| InChI | Inte angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namn och relationer
API och moderläkemedel
Sumatriptan
Föroreningar och relaterade föreningarNamn och relationer
- Sumatriptan Nitroso Impurity
05Källor
- S01PubChem CID 176481793
Structure and machine-readable chemical identifiers.
