Identitet
3',4',5'-Trifluoroacetophenone
Inte angivet · C8H5F3O
01Identitet
| Lazychem ID | LC-92075 |
|---|---|
| CAS RN | Inte angivet |
| PubChem CID | 2776907 |
| Molecular formula | C8H5F3O |
| Molecular weight | 174.12 g/mol |
| IUPAC name | 1-(3,4,5-trifluorophenyl)ethanone |
| InChIKey | KXVIYAHOUAMVJX-UHFFFAOYSA-N |
02Struktur och stereokemi
2D structurePubChem CID 2776907

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)C1=CC(=C(C(=C1)F)F)F |
|---|---|
| InChI | Inte angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namn och relationer
API och moderläkemedel
Inte angivet
Namn och relationer
05Källor
- S01PubChem CID 2776907
Structure and machine-readable chemical identifiers.
