Identitet
Ranelic Acid
Inte angivet · C12H10N2O8S
01Identitet
| Lazychem ID | LC-89776 |
|---|---|
| CAS RN | Inte angivet |
| PubChem CID | 3052774 |
| Molecular formula | C12H10N2O8S |
| Molecular weight | 342.28 g/mol |
| IUPAC name | 5-[bis(carboxymethyl)amino]-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid |
| InChIKey | DJSXNILVACEBLP-UHFFFAOYSA-N |
02Struktur och stereokemi
2D structurePubChem CID 3052774

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | C(C1=C(SC(=C1C#N)N(CC(=O)O)CC(=O)O)C(=O)O)C(=O)O |
|---|---|
| InChI | Inte angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namn och relationer
API och moderläkemedel
Inte angivet
Namn och relationer
05Källor
- S01PubChem CID 3052774
Structure and machine-readable chemical identifiers.
