Identitet
SD-208
Inte angivet · C17H10ClFN6
01Identitet
| Lazychem ID | LC-80882 |
|---|---|
| CAS RN | Inte angivet |
| PubChem CID | 10316032 |
| Molecular formula | C17H10ClFN6 |
| Molecular weight | 352.8 g/mol |
| IUPAC name | 2-(5-chloro-2-fluorophenyl)-N-pyridin-4-ylpteridin-4-amine |
| InChIKey | BERLXWPRSBJFHO-UHFFFAOYSA-N |
02Struktur och stereokemi
2D structurePubChem CID 10316032

The parsed structure contains 4 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=C(C=C1Cl)C2=NC3=NC=CN=C3C(=N2)NC4=CC=NC=C4)F |
|---|---|
| InChI | Inte angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namn och relationer
API och moderläkemedel
Inte angivet
Namn och relationer
05Källor
- S01PubChem CID 10316032
Structure and machine-readable chemical identifiers.
