Identitet
Accelerator DM
Inte angivet · C14H8N2S4
01Identitet
| Lazychem ID | LC-54220 |
|---|---|
| CAS RN | Inte angivet |
| PubChem CID | 8447 |
| Molecular formula | C14H8N2S4 |
| Molecular weight | 332.5 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole |
| InChIKey | AFZSMODLJJCVPP-UHFFFAOYSA-N |
02Struktur och stereokemi
2D structurePubChem CID 8447

The parsed structure contains 4 rings, includes aromatic atoms. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SSC3=NC4=CC=CC=C4S3 |
|---|---|
| InChI | Inte angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namn och relationer
API och moderläkemedel
Inte angivet
Namn och relationer
05Källor
- S01PubChem CID 8447
Structure and machine-readable chemical identifiers.
