Identitet
Acetaminophen Dimer Impurity
CAS 98966-17-7 · C16H16N2O4
01Identitet
| Lazychem ID | LC-04727 |
|---|---|
| CAS RN | 98966-17-7 |
| PubChem CID | 86138881 |
| Molecular formula | C16H16N2O4 |
| Molecular weight | 300.31 g/mol |
| IUPAC name | N-(5-acetamido-2-hydroxyphenyl)-N-(4-hydroxyphenyl)acetamide |
| InChIKey | NQLVUMFRDUPEJZ-UHFFFAOYSA-N |
02Struktur och stereokemi
2D structurePubChem CID 86138881

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)NC1=CC(=C(C=C1)O)N(C2=CC=C(C=C2)O)C(=O)C |
|---|---|
| InChI | Inte angivet |
03Status i Indien
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Namn och relationer
API och moderläkemedel
Acetaminophen
Föroreningar och relaterade föreningarNamn och relationer
- Acetaminophen Impurity 8
- Acetaminophen Dimer Impurity
- Paracetamol Dimer 3
- N-[3-(N-acetyl-4-hydroxyanilino)-4-hydroxyphenyl]acetamide
- N-[5-(Acetylamino)-2-hydroxyphenyl]-N-(4-hydroxyphenyl)acetamide
- 98966-17-7
- N-(5-Acetamido-2-hydroxyphenyl)-N-(4-hydroxyphenyl)acetamide
- Acetaminophen Impurity 19
- SCHEMBL30336184
- DTXSID601171997
05Källor
- S01PubChem CID 86138881
Structure and machine-readable chemical identifiers.
