Identiteta
Macitentan IMpurity
CAS 556796-88-4 · C17H15Br2N5O4S
01Identiteta
| Lazychem ID | LC-19411 |
|---|---|
| CAS RN | 556796-88-4 |
| PubChem CID | 10196441 |
| Molecular formula | C17H15Br2N5O4S |
| Molecular weight | 545.21 g/mol |
| IUPAC name | N-(5-(4-Bromophenyl)-6-(2-(5-bromopyrimidin-2-yloxy)ethoxy)pyrimidin-4-yl)methanesulfonamide |
| InChIKey | YBZPGENLNBOPON-UHFFFAOYSA-N |
02Struktura in stereokemija
2D structurePubChem CID 10196441

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CS(=O)(=O)NC1=C(C(=NC=N1)OCCOC2=NC=C(C=N2)Br)C3=CC=C(C=C3)Br |
|---|---|
| InChI | Ni navedeno |
03Status v Indiji
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Imena in povezave
API in matično zdravilo
Macitentan
Nečistote in sorodne spojineImena in povezave
- Macitentan Impurity 8
- Macitentan IMpurity
- 556796-88-4
- N-[5-(4-bromophenyl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]pyrimidin-4-yl]methanesulfonamide
- SCHEMBL5101990
- SCHEMBL31266904
05Viri
- S01PubChem CID 10196441
Structure and machine-readable chemical identifiers.
