Identiteta
Thionine acetate
Ni navedeno · C14H13N3O2S
01Identiteta
| Lazychem ID | LC-97368 |
|---|---|
| CAS RN | Ni navedeno |
| PubChem CID | 2724414 |
| Molecular formula | C14H13N3O2S |
| Molecular weight | 287.34 g/mol |
| IUPAC name | (7-aminophenothiazin-3-ylidene)azanium acetate |
| InChIKey | JOIRQYHDJINFGA-UHFFFAOYSA-N |
02Struktura in stereokemija
2D structurePubChem CID 2724414

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(=O)[O-].C1=CC2=C(C=C1N)SC3=CC(=[NH2+])C=CC3=N2 |
|---|---|
| InChI | Ni navedeno |
03Status v Indiji
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Imena in povezave
API in matično zdravilo
Ni navedeno
Imena in povezave
05Viri
- S01PubChem CID 2724414
Structure and machine-readable chemical identifiers.
