Identiteta
Agerafenib
Ni navedeno · C24H22F3N5O5
01Identiteta
| Lazychem ID | LC-57216 |
|---|---|
| CAS RN | Ni navedeno |
| PubChem CID | 56846693 |
| Molecular formula | C24H22F3N5O5 |
| Molecular weight | 517.5 g/mol |
| IUPAC name | 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]urea |
| InChIKey | DKNUPRMJNUQNHR-UHFFFAOYSA-N |
02Struktura in stereokemija
2D structurePubChem CID 56846693

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(C)(C1=CC(=NO1)NC(=O)NC2=CC(=CC=C2)OC3=NC=NC4=CC(=C(C=C43)OC)OC)C(F)(F)F |
|---|---|
| InChI | Ni navedeno |
03Status v Indiji
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Imena in povezave
API in matično zdravilo
Ni navedeno
Imena in povezave
05Viri
- S01PubChem CID 56846693
Structure and machine-readable chemical identifiers.
