Identiteta
Ditisan (base)
Ni navedeno · C19H24N2O
01Identiteta
| Lazychem ID | LC-53013 |
|---|---|
| CAS RN | Ni navedeno |
| PubChem CID | 75155 |
| Molecular formula | C19H24N2O |
| Molecular weight | 296.4 g/mol |
| IUPAC name | N,N-dimethyl-3-(11-oxido-5,6-dihydrobenzo[b][1]benzazepin-11-ium-11-yl)propan-1-amine |
| InChIKey | CADMPLPEJHVVFU-UHFFFAOYSA-N |
02Struktura in stereokemija
2D structurePubChem CID 75155

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(C)CCC[N+]1(C2=CC=CC=C2CCC3=CC=CC=C31)[O-] |
|---|---|
| InChI | Ni navedeno |
03Status v Indiji
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Imena in povezave
API in matično zdravilo
Ni navedeno
Imena in povezave
05Viri
- S01PubChem CID 75155
Structure and machine-readable chemical identifiers.
