Identiteta
3-hydroxy-2-methoxy-6-nitrobenzaldehyde
Ni navedeno · C8H7NO5
01Identiteta
| Lazychem ID | LC-46907 |
|---|---|
| CAS RN | Ni navedeno |
| PubChem CID | 10878089 |
| Molecular formula | C8H7NO5 |
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3-hydroxy-2-methoxy-6-nitrobenzaldehyde |
| InChIKey | BLNRTDPLDCWCRI-UHFFFAOYSA-N |
02Struktura in stereokemija
2D structurePubChem CID 10878089

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=C(C=CC(=C1C=O)[N+](=O)[O-])O |
|---|---|
| InChI | Ni navedeno |
03Status v Indiji
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Imena in povezave
API in matično zdravilo
Ni navedeno
Imena in povezave
- Entacapone Impurity 33
05Viri
- S01PubChem CID 10878089
Structure and machine-readable chemical identifiers.
