Identiteta
Azure C
Ni navedeno · C13H12ClN3S
01Identiteta
| Lazychem ID | LC-34919 |
|---|---|
| CAS RN | Ni navedeno |
| PubChem CID | 135421845 |
| Molecular formula | C13H12ClN3S |
| Molecular weight | 277.77 g/mol |
| IUPAC name | 7-methyliminophenothiazin-10-ium-3-amine chloride |
| InChIKey | DDGMDTGNGDOUPX-UHFFFAOYSA-N |
02Struktura in stereokemija
2D structurePubChem CID 135421845

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CN=C1C=CC2=[NH+]C3=C(C=C(C=C3)N)SC2=C1.[Cl-] |
|---|---|
| InChI | Ni navedeno |
03Status v Indiji
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Imena in povezave
API in matično zdravilo
Ni navedeno
Imena in povezave
05Viri
- S01PubChem CID 135421845
Structure and machine-readable chemical identifiers.
