Identiteta
3,4-Dimethoxycinnamic acid
Ni navedeno · C11H12O4
01Identiteta
| Lazychem ID | LC-102524 |
|---|---|
| CAS RN | Ni navedeno |
| PubChem CID | 717531 |
| Molecular formula | C11H12O4 |
| Molecular weight | 208.21 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-N |
02Struktura in stereokemija
2D structurePubChem CID 717531

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)O)OC |
|---|---|
| InChI | Ni navedeno |
03Status v Indiji
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Imena in povezave
API in matično zdravilo
Ni navedeno
Imena in povezave
05Viri
- S01PubChem CID 717531
Structure and machine-readable chemical identifiers.
