Identita
N-Nitroso Risdiplam
Neuvedené · C22H22N8O2
01Identita
| Lazychem ID | LC-22365 |
|---|---|
| CAS RN | Neuvedené |
| PubChem CID | 172866450 |
| Molecular formula | C22H22N8O2 |
| Molecular weight | 430.5 g/mol |
| IUPAC name | 2-(2,8-Dimethylimidazo[1,2-b]pyridazin-6-yl)-7-(4-nitroso-4,7-diazaspiro[2.5]octan-7-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | KJXQFHPVITXUDY-UHFFFAOYSA-N |
02Štruktúra a stereochémia
2D structurePubChem CID 172866450

The parsed structure contains 6 rings, includes aromatic atoms, includes aliphatic carbon, contains an N-nitroso substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 6 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | O=C1C=C(C2=NN3C(C(C)=C2)=NC(C)=C3)N=C4N1C=C(N(C5)CCN(N=O)C65CC6)C=C4 |
|---|---|
| InChI | Neuvedené |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vzťahy
API a materské liečivo
Risdiplam
Nečistoty a súvisiace zlúčeninyNázvy a vzťahy
05Zdroje
- S01PubChem CID 172866450
Structure and machine-readable chemical identifiers.
