Identita
Pomalidomide Impurity A
CAS 641-70-3 · C8H3NO5
01Identita
| Lazychem ID | LC-25653 |
|---|---|
| CAS RN | 641-70-3 |
| PubChem CID | 21631 |
| Molecular formula | C8H3NO5 |
| Molecular weight | 193.11 g/mol |
| IUPAC name | 4-nitroisobenzofuran-1,3-dione |
| InChIKey | ROFZMKDROVBLNY-UHFFFAOYSA-N |
02Štruktúra a stereochémia
2D structurePubChem CID 21631

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | O=C1OC(C2=CC=CC([N+]([O-])=O)=C21)=O |
|---|---|
| InChI | Neuvedené |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vzťahy
API a materské liečivo
Pomalidomide
Nečistoty a súvisiace zlúčeninyNázvy a vzťahy
- 4-Nitro-2-benzofuran-1,3-dione
- 3-nitro-phtalic anhydride
05Zdroje
- S01PubChem CID 21631
Structure and machine-readable chemical identifiers.
