Identita
Dapsone EP Impurity C/ Dapsone Ether Dimer Impurity
CAS 54616-64-7 · C24H20N2O5S2
01Identita
| Lazychem ID | LC-11963 |
|---|---|
| CAS RN | 54616-64-7 |
| PubChem CID | 18401317 |
| Molecular formula | C24H20N2O5S2 |
| Molecular weight | 480.56 g/mol |
| IUPAC name | 4,4'-(4,4'-oxybis(4,1-phenylenesulfonyl))dianiline |
| InChIKey | CAIMXHCQEIPTCR-UHFFFAOYSA-N |
02Štruktúra a stereochémia
2D structurePubChem CID 18401317

The parsed structure contains 4 rings, includes aromatic atoms. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)S(=O)(=O)C4=CC=C(C=C4)N |
|---|---|
| InChI | Neuvedené |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vzťahy
API a materské liečivo
Dapsone
Nečistoty a súvisiace zlúčeninyNázvy a vzťahy
- 4-(4-(4-(4-Aminophenyl)sulfonylphenoxy)phenyl)sulfonylaniline
- RefChem:513587
- 954-762-2
- 54616-64-7
- 4,4'-(Oxybis(4,1-phenylenesulfonyl))dianiline
- 4,4'-Oxybis[p-(phenylsulfonylaniline)]
- Dapsone O-Dimer
- Acedapsone Impurity 1
- SCHEMBL7463604
- DTXSID40593406
- MFCD00625772
- G90779
05Zdroje
- S01PubChem CID 18401317
Structure and machine-readable chemical identifiers.
