
Identita
3beta-Hydroxytibolone
Neuvedené · C21H30O2
01Identita
| Lazychem ID | LC-48075 |
|---|---|
| CAS RN | Neuvedené |
| PubChem CID | 9839851 |
| Molecular formula | C21H30O2 |
| Molecular weight | 314.5 g/mol |
| IUPAC name | (3S,7R,8R,9S,13S,14S,17R)-17-ethynyl-7,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | YLEUWNOTNJZCBN-XAAPQAIWSA-N |
02Štruktúra a stereochémia

The parsed structure contains 4 rings, includes aliphatic carbon, has 7 defined stereocentres. These statements are calculated from the published structure string.
| Defined stereocentres | 7 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C[C@@H]1CC2=C(CC[C@@H](C2)O)[C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(C#C)O |
|---|---|
| InChI | Neuvedené |
03Stereochemistry
The published structure contains 7 defined and 0 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
2 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.


Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Názvy a vzťahy
API a materské liečivo
Neuvedené
Názvy a vzťahy
06Zdroje
- S01PubChem CID 9839851
Structure and machine-readable chemical identifiers.
