
Identita
b-Hydroxy Thyroxine
Neuvedené · C15H11I4NO5
01Identita
| Lazychem ID | LC-36686 |
|---|---|
| CAS RN | Neuvedené |
| PubChem CID | 92018381 |
| Molecular formula | C15H11I4NO5 |
| Molecular weight | 792.87 g/mol |
| IUPAC name | 2-amino-3-hydroxy-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| InChIKey | QIFVILYTCIFAPL-UHFFFAOYSA-N |
02Štruktúra a stereochémia

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)C(C(C(=O)O)N)O |
|---|---|
| InChI | Neuvedené |
03Stereochemistry
The published structure contains 0 defined and 2 unassigned tetrahedral stereocentres. The exact wedge and dash depiction is shown above.
Published same-connectivity configurations
2 recordsThese records have the same connectivity, molecular formula and protonation layer, but a different complete InChIKey stereochemical layer. Only separately structure-linked records are shown.


Levothyroxine beta-Hydroxy Impurity
CAS 107849-54-7
QIFVILYTCIFAPL-PXYINDEMSA-N
1 defined, 1 unassigned centres
Scope: The mathematical 2^n value is only an upper bound. Symmetry and other stereogenic elements can change the number of distinct stereoisomers. A hypothetical configuration is not published as a compound record without a verified structure identity.
04Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
05Názvy a vzťahy
API a materské liečivo
Neuvedené
Názvy a vzťahy
06Zdroje
- S01PubChem CID 92018381
Structure and machine-readable chemical identifiers.
