Identita
2,4-Dichlorocinnamic acid, (E)-
Neuvedené · C9H6Cl2O2
01Identita
| Lazychem ID | LC-103161 |
|---|---|
| CAS RN | Neuvedené |
| PubChem CID | 688026 |
| Molecular formula | C9H6Cl2O2 |
| Molecular weight | 217.05 g/mol |
| IUPAC name | (E)-3-(2,4-dichlorophenyl)prop-2-enoic acid |
| InChIKey | MEBWABJHRAYGFW-DUXPYHPUSA-N |
02Štruktúra a stereochémia
2D structurePubChem CID 688026

The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)/C=C/C(=O)O |
|---|---|
| InChI | Neuvedené |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vzťahy
API a materské liečivo
Neuvedené
Názvy a vzťahy
05Zdroje
- S01PubChem CID 688026
Structure and machine-readable chemical identifiers.
