Identita
5-hydroxybisphenol A
CAS 79371-66-7 · C15H16O3
01Identita
| Lazychem ID | LC-08416 |
|---|---|
| CAS RN | 79371-66-7 |
| PubChem CID | 656689 |
| Molecular formula | C15H16O3 |
| Molecular weight | 244.29 g/mol |
| IUPAC name | 4-(2-(4-hydroxyphenyl)propan-2-yl)benzene-1,2-diol |
| InChIKey | YGFAMQHMUSBLBC-UHFFFAOYSA-N |
02Štruktúra a stereochémia
2D structurePubChem CID 656689

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC(=C(C=C2)O)O |
|---|---|
| InChI | Neuvedené |
03Stav v Indii
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Názvy a vzťahy
API a materské liečivo
Bisphenol A
Nečistoty a súvisiace zlúčeninyNázvy a vzťahy
- Bisphenol A Impurity 10/ 5-hydroxybisphenol A
- Bisphenol A Impurity 10
- 5-hydroxybisphenol A
- 4-[1-(4-hydroxyphenyl)-1-methylethyl]benzene-1,2-diol
- BPA catechol
05Zdroje
- S01PubChem CID 656689
Structure and machine-readable chemical identifiers.
