Identitate
Phenylbutazone EP Impurity E/ Benzidine
CAS 92-87-5 · C12H12N2
01Identitate
| Lazychem ID | LC-25113 |
|---|---|
| CAS RN | 92-87-5 |
| PubChem CID | 7111 |
| Molecular formula | C12H12N2 |
| Molecular weight | 184.24 g/mol |
| IUPAC name | Biphenyl-4,4`-diamine |
| InChIKey | HFACYLZERDEVSX-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 7111

The parsed structure contains 2 rings, includes aromatic atoms. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N)N |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Phenylbutazone
Impurități și compuși înrudițiDenumiri și relații
- Phenylbutazone EP Impurity E
- Benzidine
- 4,4'-Diaminobiphenyl
- [1,1'-Biphenyl]-4,4'-diamine
- p-Diaminodiphenyl
- 4-(4-aminophenyl)aniline
- 4,4'-Bianiline
- p,p-Bianiline
- p,p'-Diaminobiphenyl
- 4,4'-Diamino-1,1'-biphenyl
05Surse
- S01PubChem CID 7111
Structure and machine-readable chemical identifiers.
