Identitate
Dapsone EP Impurity E/ Dapsone Aniline Chlorophenyl Impurity
CAS 7146-68-1 · C12H10ClNO2S
01Identitate
| Lazychem ID | LC-11965 |
|---|---|
| CAS RN | 7146-68-1 |
| PubChem CID | 229818 |
| Molecular formula | C12H10ClNO2S |
| Molecular weight | 267.73 g/mol |
| IUPAC name | 4-((4-chlorophenyl)sulfonyl)aniline |
| InChIKey | RWIUBJDOESNTFZ-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 229818

The parsed structure contains 2 rings, includes aromatic atoms, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)Cl |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Dapsone
Impurități și compuși înrudițiDenumiri și relații
- Dapsone EP Impurity E
- Dapsone Aniline Chlorophenyl Impurity
- 4-Amino-4'-chlorodiphenyl Sulfone
- 4-[(4-Chlorophenyl)sulfonyl]benzenamine
- p-[(p-Chlorophenyl)sulfonyl]aniline
- 4-(4-Chlorobenzenesulfonyl)phenylamine
- 4-Aminophenyl 4-chlorophenyl Sulfone
- NSC 23812
- NSC 51990
- p-Aminophenyl p-Chlorophenyl Sulfone
- 4-((4-Chlorophenyl)sulfonyl)aniline
- 7146-68-1
05Surse
- S01PubChem CID 229818
Structure and machine-readable chemical identifiers.
