Identitate
Stf-31
Nu este indicat · C23H25N3O3S
01Identitate
| Lazychem ID | LC-99342 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 984333 |
| Molecular formula | C23H25N3O3S |
| Molecular weight | 423.5 g/mol |
| IUPAC name | 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
| InChIKey | NGQPRVWTFNBUHA-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 984333
The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)NC3=CN=CC=C3 |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 984333
Structure and machine-readable chemical identifiers.