Identitate
PyBroP
Nu este indicat · C12H24BrF6N3P2
01Identitate
| Lazychem ID | LC-97095 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 2733179 |
| Molecular formula | C12H24BrF6N3P2 |
| Molecular weight | 466.18 g/mol |
| IUPAC name | bromo(tripyrrolidin-1-yl)phosphanium hexafluorophosphate |
| InChIKey | CYKRMWNZYOIJCH-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 2733179
The parsed structure contains 3 rings, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 3 |
| SMILES | C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)Br.F[P-](F)(F)(F)(F)F |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 2733179
Structure and machine-readable chemical identifiers.