Identitate
1,8-Dibromoperfluorooctane
Nu este indicat · C8Br2F16
01Identitate
| Lazychem ID | LC-95747 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 2736786 |
| Molecular formula | C8Br2F16 |
| Molecular weight | 559.87 g/mol |
| IUPAC name | 1,8-dibromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane |
| InChIKey | LYRJPHOHVRHNQH-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 2736786

The parsed structure is acyclic, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 0 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C(C(C(C(C(F)(F)Br)(F)F)(F)F)(F)F)(C(C(C(F)(F)Br)(F)F)(F)F)(F)F |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 2736786
Structure and machine-readable chemical identifiers.
