Identitate
3-Nitrobenzohydrazide
Nu este indicat · C7H7N3O3
01Identitate
| Lazychem ID | LC-89198 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 3291498 |
| Molecular formula | C7H7N3O3 |
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-nitrobenzohydrazide |
| InChIKey | NQEWXLVDAVTOHM-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 3291498
The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NN |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 3291498
Structure and machine-readable chemical identifiers.