Identitate
Sto-609
Nu este indicat · C19H10N2O3
01Identitate
| Lazychem ID | LC-88942 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 3467590 |
| Molecular formula | C19H10N2O3 |
| Molecular weight | 314.3 g/mol |
| IUPAC name | 11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4,6,8,12,14,16,18-nonaene-17-carboxylic acid |
| InChIKey | MYKOWOGZBMOVBJ-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 3467590

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(=O)C4=CC=CC5=C(C=CC3=C54)C(=O)O |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 3467590
Structure and machine-readable chemical identifiers.
