Identitate
5,7-Dimethoxyindan-1-one
Nu este indicat · C11H12O3
01Identitate
| Lazychem ID | LC-87139 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 4370207 |
| Molecular formula | C11H12O3 |
| Molecular weight | 192.21 g/mol |
| IUPAC name | 5,7-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | ZLTCXTRHEQUDGV-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 4370207

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=CC2=C(C(=O)CC2)C(=C1)OC |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 4370207
Structure and machine-readable chemical identifiers.
