Identitate
16,17-Dihydroxyviolanthrone
Nu este indicat · C34H16O4
01Identitate
| Lazychem ID | LC-84956 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 5354980 |
| Molecular formula | C34H16O4 |
| Molecular weight | 488.5 g/mol |
| IUPAC name | 30,34-dihydroxynonacyclo[18.10.2.22,5.03,16.04,13.06,11.017,31.022,27.028,32]tetratriaconta-1(30),2(34),3(16),4(13),5(33),6,8,10,14,17(31),18,20(32),22,24,26,28-hexadecaene-12,21-dione |
| InChIKey | MGYICCKROPVHMA-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 5354980

The parsed structure contains 9 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 9 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C2C(=C1)C3=CC(=C4C5=C(C=CC(=C35)C2=O)C6=C7C4=C(C=C8C7=C(C=C6)C(=O)C9=CC=CC=C98)O)O |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 5354980
Structure and machine-readable chemical identifiers.
