Identitate
Dehydroevodiamine
Nu este indicat · C19H15N3O
01Identitate
| Lazychem ID | LC-82006 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 9817839 |
| Molecular formula | C19H15N3O |
| Molecular weight | 301.3 g/mol |
| IUPAC name | 21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1,3,5,7,9,15,17,19-octaen-14-one |
| InChIKey | VXHNSVKJHXSKKM-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 9817839

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN1C2=CC=CC=C2C(=O)N3C1=C4C(=C5C=CC=CC5=N4)CC3 |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 9817839
Structure and machine-readable chemical identifiers.
