Identitate
Mln8054
Nu este indicat · C25H15ClF2N4O2
01Identitate
| Lazychem ID | LC-76662 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 11712649 |
| Molecular formula | C25H15ClF2N4O2 |
| Molecular weight | 476.9 g/mol |
| IUPAC name | 4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]benzoic acid |
| InChIKey | HHFBDROWDBDFBR-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 11712649

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | C1C2=CN=C(N=C2C3=C(C=C(C=C3)Cl)C(=N1)C4=C(C=CC=C4F)F)NC5=CC=C(C=C5)C(=O)O |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 11712649
Structure and machine-readable chemical identifiers.
