Identitate
Onalespib
Nu este indicat · C24H31N3O3
01Identitate
| Lazychem ID | LC-76219 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 11955716 |
| Molecular formula | C24H31N3O3 |
| Molecular weight | 409.5 g/mol |
| IUPAC name | (2,4-dihydroxy-5-propan-2-ylphenyl)-[5-[(4-methylpiperazin-1-yl)methyl]-1,3-dihydroisoindol-2-yl]methanone |
| InChIKey | IFRGXKKQHBVPCQ-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 11955716

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | CC(C)C1=CC(=C(C=C1O)O)C(=O)N2CC3=C(C2)C=C(C=C3)CN4CCN(CC4)C |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 11955716
Structure and machine-readable chemical identifiers.
