Identitate
Pf-04217903
Nu este indicat · C19H16N8O
01Identitate
| Lazychem ID | LC-69344 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 17754438 |
| Molecular formula | C19H16N8O |
| Molecular weight | 372.4 g/mol |
| IUPAC name | 2-[4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]pyrazol-1-yl]ethanol |
| InChIKey | PDMUGYOXRHVNMO-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 17754438

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC2=C(C=CC(=C2)CN3C4=NC(=CN=C4N=N3)C5=CN(N=C5)CCO)N=C1 |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 17754438
Structure and machine-readable chemical identifiers.
