Identitate
PP121
Nu este indicat · C17H17N7
01Identitate
| Lazychem ID | LC-63529 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 24905142 |
| Molecular formula | C17H17N7 |
| Molecular weight | 319.4 g/mol |
| IUPAC name | 1-cyclopentyl-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | NVRXTLZYXZNATH-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 24905142

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1CCC(C1)N2C3=NC=NC(=C3C(=N2)C4=CN=C5C(=C4)C=CN5)N |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 24905142
Structure and machine-readable chemical identifiers.
