Identitate
Dasabuvir
Nu este indicat · C26H27N3O5S
01Identitate
| Lazychem ID | LC-57319 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 56640146 |
| Molecular formula | C26H27N3O5S |
| Molecular weight | 493.6 g/mol |
| IUPAC name | N-[6-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]naphthalen-2-yl]methanesulfonamide |
| InChIKey | NBRBXGKOEOGLOI-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 56640146

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC(C)(C)C1=CC(=CC(=C1OC)C2=CC3=C(C=C2)C=C(C=C3)NS(=O)(=O)C)N4C=CC(=O)NC4=O |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 56640146
Structure and machine-readable chemical identifiers.
