Identitate
Nms-873
Nu este indicat · C27H28N4O3S2
01Identitate
| Lazychem ID | LC-55681 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 71521142 |
| Molecular formula | C27H28N4O3S2 |
| Molecular weight | 520.7 g/mol |
| IUPAC name | 3-[3-cyclopentylsulfanyl-5-[[3-methyl-4-(4-methylsulfonylphenyl)phenoxy]methyl]-1,2,4-triazol-4-yl]pyridine |
| InChIKey | UJGTUKMAJVCBIS-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 71521142

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=C(C=CC(=C1)OCC2=NN=C(N2C3=CN=CC=C3)SC4CCCC4)C5=CC=C(C=C5)S(=O)(=O)C |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 71521142
Structure and machine-readable chemical identifiers.
