Identitate
Unc1999
Nu este indicat · C33H43N7O2
01Identitate
| Lazychem ID | LC-55538 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 72551585 |
| Molecular formula | C33H43N7O2 |
| Molecular weight | 569.7 g/mol |
| IUPAC name | N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-1-propan-2-yl-6-[6-(4-propan-2-ylpiperazin-1-yl)-3-pyridinyl]indazole-4-carboxamide |
| InChIKey | DPJNKUOXBZSZAI-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 72551585

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 2 |
| SMILES | CCCC1=C(C(=O)NC(=C1)C)CNC(=O)C2=C3C=NN(C3=CC(=C2)C4=CN=C(C=C4)N5CCN(CC5)C(C)C)C(C)C |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 72551585
Structure and machine-readable chemical identifiers.
