Identitate
Relugolix Impurity 1
Nu este indicat · C27H22F2N6O5S
01Identitate
| Lazychem ID | LC-37710 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 73505508 |
| Molecular formula | C27H22F2N6O5S |
| Molecular weight | 580.6 g/mol |
| IUPAC name | 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-3-(6-methoxypyridazin-3-yl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione |
| InChIKey | VFWMXMJJWKJIQM-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 73505508

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(C)CC1=C(SC2=C1C(=O)N(C(=O)N2CC3=C(C=CC=C3F)F)C4=NN=C(C=C4)OC)C5=CC=C(C=C5)[N+](=O)[O-] |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 73505508
Structure and machine-readable chemical identifiers.
