Identitate
Avoralstat
Nu este indicat · C28H27N5O5
01Identitate
| Lazychem ID | LC-37248 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 86566678 |
| Molecular formula | C28H27N5O5 |
| Molecular weight | 513.5 g/mol |
| IUPAC name | 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylic acid |
| InChIKey | TUWMKPVJGGWGNL-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 86566678

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=CC(=C(C=C1C=C)C(=O)NC2=CC=C(C=C2)C(=N)N)C3=C(N=C(C=C3)C(=O)NCC4CC4)C(=O)O |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 86566678
Structure and machine-readable chemical identifiers.
