Identitate
Dioxopyritrione
Nu este indicat · C20H20N2O6
01Identitate
| Lazychem ID | LC-35123 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 132010357 |
| Molecular formula | C20H20N2O6 |
| Molecular weight | 384.4 g/mol |
| IUPAC name | 2-[2-(3,4-dimethoxyphenyl)-6-methyl-3-oxopyridazine-4-carbonyl]cyclohexane-1,3-dione |
| InChIKey | ANQRDMDBJYHVII-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 132010357

The parsed structure contains 3 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 3 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=NN(C(=O)C(=C1)C(=O)C2C(=O)CCCC2=O)C3=CC(=C(C=C3)OC)OC |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 132010357
Structure and machine-readable chemical identifiers.
