Identitate
Bensultap
Nu este indicat · C17H21NO4S4
01Identitate
| Lazychem ID | LC-119208 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 87176 |
| Molecular formula | C17H21NO4S4 |
| Molecular weight | 431.6 g/mol |
| IUPAC name | 1,3-bis(benzenesulfonylsulfanyl)-N,N-dimethylpropan-2-amine |
| InChIKey | YFXPPSKYMBTNAV-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 87176

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(C)C(CSS(=O)(=O)C1=CC=CC=C1)CSS(=O)(=O)C2=CC=CC=C2 |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 87176
Structure and machine-readable chemical identifiers.
