Identitate
Triptycene
Nu este indicat · C20H14
01Identitate
| Lazychem ID | LC-118263 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 92764 |
| Molecular formula | C20H14 |
| Molecular weight | 254.3 g/mol |
| IUPAC name | pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene |
| InChIKey | NGDCLPXRKSWRPY-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 92764

The parsed structure contains 6 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 6 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C2C3C4=CC=CC=C4C(C2=C1)C5=CC=CC=C35 |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 92764
Structure and machine-readable chemical identifiers.
