Identitate
Aristolactam
Nu este indicat · C17H11NO4
01Identitate
| Lazychem ID | LC-117485 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 96710 |
| Molecular formula | C17H11NO4 |
| Molecular weight | 293.27 g/mol |
| IUPAC name | 14-methoxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(18),2(6),7,11(19),12,14,16-heptaen-9-one |
| InChIKey | MXOKGWUJNGEKBH-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 96710

The parsed structure contains 5 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 5 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | COC1=CC=CC2=C3C4=C(C=C21)NC(=O)C4=CC5=C3OCO5 |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 96710
Structure and machine-readable chemical identifiers.
