Identitate
5-Methyl-2-nitroanisole
Nu este indicat · C8H9NO3
01Identitate
| Lazychem ID | LC-117348 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 97455 |
| Molecular formula | C8H9NO3 |
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-methoxy-4-methyl-1-nitrobenzene |
| InChIKey | XCOUVPWGTSKINY-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 97455
The parsed structure contains 1 ring, includes aromatic atoms, includes aliphatic carbon, contains a nitro substructure. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 1 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])OC |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 97455
Structure and machine-readable chemical identifiers.