Identitate
Tribenuron-methyl
Nu este indicat · C15H17N5O6S
01Identitate
| Lazychem ID | LC-113705 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 153909 |
| Molecular formula | C15H17N5O6S |
| Molecular weight | 395.4 g/mol |
| IUPAC name | methyl 2-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-methylcarbamoyl]sulfamoyl]benzoate |
| InChIKey | VLCQZHSMCYCDJL-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 153909

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | CC1=NC(=NC(=N1)OC)N(C)C(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 153909
Structure and machine-readable chemical identifiers.
