Identitate
Taspine
Nu este indicat · C20H19NO6
01Identitate
| Lazychem ID | LC-112337 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 215159 |
| Molecular formula | C20H19NO6 |
| Molecular weight | 369.4 g/mol |
| IUPAC name | 5-[2-(dimethylamino)ethyl]-7,14-dimethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-3,10-dione |
| InChIKey | MTAWKURMWOXCEO-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 215159

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(C)CCC1=CC(=C2C3=C1C(=O)OC4=C(C=CC(=C34)C(=O)O2)OC)OC |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 215159
Structure and machine-readable chemical identifiers.
