Identitate
PD173955
Nu este indicat · C21H16Cl2N4OS
01Identitate
| Lazychem ID | LC-107445 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 447077 |
| Molecular formula | C21H16Cl2N4OS |
| Molecular weight | 443.3 g/mol |
| IUPAC name | 6-(2,6-dichlorophenyl)-8-methyl-2-(3-methylsulfanylanilino)pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | VAARYSWULJUGST-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 447077
The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon, contains at least one halogen atom. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 1 |
| Tertiary amines | 0 |
| SMILES | CN1C2=NC(=NC=C2C=C(C1=O)C3=C(C=CC=C3Cl)Cl)NC4=CC(=CC=C4)SC |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 447077
Structure and machine-readable chemical identifiers.