Identitate
Smer3
Nu este indicat · C11H4N4O2
01Identitate
| Lazychem ID | LC-105790 |
|---|---|
| CAS RN | Nu este indicat |
| PubChem CID | 568763 |
| Molecular formula | C11H4N4O2 |
| Molecular weight | 224.17 g/mol |
| IUPAC name | 13-oxa-10,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,14-heptaen-8-one |
| InChIKey | SFSSAKVWCKFRHE-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 568763

The parsed structure contains 4 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 4 |
| Secondary amines | 0 |
| Tertiary amines | 0 |
| SMILES | C1=CC=C2C(=C1)C3=NC4=NON=C4N=C3C2=O |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
05Surse
- S01PubChem CID 568763
Structure and machine-readable chemical identifiers.
