Identitate
Dofetilide
CAS 115256-11-6 · C19H27N3O5S2
01Identitate
| Lazychem ID | LC-100921 |
|---|---|
| CAS RN | 115256-11-6 |
| PubChem CID | 71329 |
| Molecular formula | C19H27N3O5S2 |
| Molecular weight | 441.6 g/mol |
| IUPAC name | N-[4-[2-[2-[4-(methanesulfonamido)phenoxy]ethyl-methylamino]ethyl]phenyl]methanesulfonamide |
| InChIKey | IXTMWRCNAAVVAI-UHFFFAOYSA-N |
02Structură și stereochimie
2D structurePubChem CID 71329

The parsed structure contains 2 rings, includes aromatic atoms, includes aliphatic carbon. These statements are calculated from the published structure string.
| Defined stereocentres | 0 |
|---|---|
| Ring count | 2 |
| Secondary amines | 0 |
| Tertiary amines | 1 |
| SMILES | CN(CCC1=CC=C(C=C1)NS(=O)(=O)C)CCOC2=CC=C(C=C2)NS(=O)(=O)C |
|---|---|
| InChI | Nu este indicat |
03Statut în India
Exact-compound status is evaluated only against the published name and CAS number. Confirm the current official instrument before a regulatory decision.
04Denumiri și relații
API și medicament părinte
Nu este indicat
Denumiri și relații
- Dofetilide
- 115256-11-6
- Tikosyn
- Dofetilida
- Dofetilidum
- UK-68,798
- DTXSID5046433
- R4Z9X1N2ND
- beta-((p-Methanesulfonamidophenethyl)methylamino)methanesulfono-p-phenetidide
- Methanesulfonamide, N-[4-[2-[methyl[2-[4-[(methylsulfonyl)amino]phenoxy]ethyl]amino]ethyl]phenyl]-
- CHEBI:4681
- DTXCID3026433
05Surse
- S01PubChem CID 71329
Structure and machine-readable chemical identifiers.
